|
CAS#: 20556-16-5 Product: L-Valyl-L-Aspartic Acid No suppilers available for the product. |
| Name | L-Valyl-L-Aspartic Acid |
|---|---|
| Synonyms | H-VAL-ASP-OH; L-Val-L-Asp; L-valyl-L-aspartic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.23 |
| CAS Registry Number | 20556-16-5 |
| SMILES | O=C(N[C@H](C(=O)O)CC(=O)O)[C@@H](N)C(C)C |
| InChI | 1S/C9H16N2O5/c1-4(2)7(10)8(14)11-5(9(15)16)3-6(12)13/h4-5,7H,3,10H2,1-2H3,(H,11,14)(H,12,13)(H,15,16)/t5-,7-/m0/s1 |
| InChIKey | OBTCMSPFOITUIJ-FSPLSTOPSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.302°C at 760 mmHg (Cal.) |
| Flash point | 228.554°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Valyl-L-Aspartic Acid |