|
CAS#: 28130-13-4 Product: H-Val-Val-Val-OH No suppilers available for the product. |
| Name | H-Val-Val-Val-OH |
|---|---|
| Synonyms | 2-[[2-[(2-Amino-3-Methyl-Butanoyl)Amino]-3-Methyl-Butanoyl]Amino]-3-Methyl-Butanoic Acid; 2-[[2-[(2-Amino-3-Methyl-1-Oxobutyl)Amino]-3-Methyl-1-Oxobutyl]Amino]-3-Methylbutanoic Acid; 2-[[2-[(2-Amino-3-Methyl-Butanoyl)Amino]-3-Methyl-Butanoyl]Amino]-3-Methyl-Butyric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 |
| CAS Registry Number | 28130-13-4 (28275-71-0) |
| SMILES | CC(C(C(NC(C(C)C)C(O)=O)=O)NC(C(C(C)C)N)=O)C |
| InChI | 1S/C15H29N3O4/c1-7(2)10(16)13(19)17-11(8(3)4)14(20)18-12(9(5)6)15(21)22/h7-12H,16H2,1-6H3,(H,17,19)(H,18,20)(H,21,22) |
| InChIKey | LSLXWOCIIFUZCQ-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 565.923°C at 760 mmHg (Cal.) |
| Flash point | 296.06°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for H-Val-Val-Val-OH |