|
CAS#: 20696-60-0 Product: H-Trp-Trp-Oh No suppilers available for the product. |
| Name | H-Trp-Trp-Oh |
|---|---|
| Synonyms | 2-[[2-Amino-3-(1H-Indol-3-Yl)-1-Oxopropyl]Amino]-3-(1H-Indol-3-Yl)Propanoic Acid; 2-[[2-Amino-3-(1H-Indol-3-Yl)Propanoyl]Amino]-3-(1H-Indol-3-Yl)Propionic Acid; Nsc524592 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N4O3 |
| Molecular Weight | 390.44 |
| CAS Registry Number | 20696-60-0 |
| SMILES | C1=CC=CC2=C1C(=C[NH]2)CC(NC(C(CC3=C[NH]C4=C3C=CC=C4)N)=O)C(O)=O |
| InChI | 1S/C22H22N4O3/c23-17(9-13-11-24-18-7-3-1-5-15(13)18)21(27)26-20(22(28)29)10-14-12-25-19-8-4-2-6-16(14)19/h1-8,11-12,17,20,24-25H,9-10,23H2,(H,26,27)(H,28,29) |
| InChIKey | NQIHMZLGCZNZBN-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 791.125°C at 760 mmHg (Cal.) |
| Flash point | 432.257°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for H-Trp-Trp-Oh |