| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Tryprostatin A |
|---|---|
| Synonyms | (3S,8aS)-3-{[6-methoxy-2-(3-methylbut-2-en-1-yl)-1H-indol-3-yl]methyl}hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.47 |
| CAS Registry Number | 171864-80-5 |
| SMILES | CC(=CCC1=C(C2=C(N1)C=C(C=C2)OC)CC3C(=O)N4CCCC4C(=O)N3)C |
| InChI | 1S/C22H27N3O3/c1-13(2)6-9-17-16(15-8-7-14(28-3)11-18(15)23-17)12-19-22(27)25-10-4-5-20(25)21(26)24-19/h6-8,11,19-20,23H,4-5,9-10,12H2,1-3H3,(H,24,26)/t19-,20-/m0/s1 |
| InChIKey | XNRPVPHNDQHWLJ-PMACEKPBSA-N |
| Density | 1.26g/cm3 (Expl.) |
|---|---|
| Melting point | 120-123°C (Expl.) |
| Boiling point | 666.43°C at 760 mmHg (Expl.) |
| solubility | Soluble in methanol, absolute ethanol, and DMSO. |
| Market Analysis Reports |
| List of Reports Available for Tryprostatin A |