| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| MP Biomedicals LLC. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2,5-Bis(4-Phenylphenyl)-1,3-Oxazole |
|---|---|
| Synonyms | 2,5-Bis(4-Phenylphenyl)Oxazole; 2,5-Di(Biphenyl-4-Yl)Oxazole |
| Molecular Structure | ![]() |
| Molecular Formula | C27H19NO |
| Molecular Weight | 373.45 |
| CAS Registry Number | 2083-09-2 |
| EINECS | 218-220-2 |
| SMILES | C3=C(C1=CC=C(C=C1)C2=CC=CC=C2)OC(=N3)C4=CC=C(C=C4)C5=CC=CC=C5 |
| InChI | 1S/C27H19NO/c1-3-7-20(8-4-1)22-11-15-24(16-12-22)26-19-28-27(29-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
| InChIKey | DDZJGFHXUOWOSL-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Melting point | 238-240°C (Expl.) |
| Boiling point | 592.4±58.0°C at 760 mmHg (Cal.) |
| Flash point | 259.6±28.2°C (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(4-Phenylphenyl)-1,3-Oxazole |