|
CAS#: 20972-54-7 Product: 3-(2-Bromoethyl)Coumarin No suppilers available for the product. |
| Name | 3-(2-Bromoethyl)Coumarin |
|---|---|
| Synonyms | 3-(2-Bromoethyl)-2-Chromenone; 3-(2-Bromoethyl)Coumarin; Nsc99029 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.09 |
| CAS Registry Number | 20972-54-7 |
| SMILES | C1=CC=CC2=C1C=C(CCBr)C(O2)=O |
| InChI | 1S/C11H9BrO2/c12-6-5-9-7-8-3-1-2-4-10(8)14-11(9)13/h1-4,7H,5-6H2 |
| InChIKey | KWYQUOMBGREDBP-UHFFFAOYSA-N |
| Density | 1.526g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.092°C at 760 mmHg (Cal.) |
| Flash point | 176.416°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2-Bromoethyl)Coumarin |