Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 3-Bromo-6-Ethyl-4H-Chromen-4-One |
|---|---|
| Synonyms | 4H-1-BENZOPYRAN-4-ONE,3-BROMO-6-ETHYL- |
| Molecular Structure |  |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.09 |
| CAS Registry Number | 288399-50-8 |
| SMILES | CCc1ccc2c(c1)c(=O)c(co2)Br |
| InChI | 1S/C11H9BrO2/c1-2-7-3-4-10-8(5-7)11(13)9(12)6-14-10/h3-6H,2H2,1H3 |
| InChIKey | XIDGUEFLSKPUHF-UHFFFAOYSA-N |
| Density | 1.56g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.278°C at 760 mmHg (Cal.) |
| Flash point | 143.871°C (Cal.) |
| Refractive index | 1.621 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-6-Ethyl-4H-Chromen-4-One |