Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(Dimethylamino)Naphtho[2,3-b]Furan-4,9-Dione |
|---|---|
| Synonyms | 2-(dimethylamino)naphtho[2,3-b]furan-4,9-dione |
| Molecular Structure | ![CAS#: 210117-62-7， 2-(Dimethylamino)Naphtho[2,3-b]Furan-4,9-Dione](/moreStructures/210117-62-7.gif) |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.24 |
| CAS Registry Number | 210117-62-7 |
| SMILES | O=C2c1oc(cc1C(=O)c3c2cccc3)N(C)C |
| InChI | 1S/C14H11NO3/c1-15(2)11-7-10-12(16)8-5-3-4-6-9(8)13(17)14(10)18-11/h3-7H,1-2H3 |
| InChIKey | BPTCJHDNVAUSLR-UHFFFAOYSA-N |
| Density | 1.341g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.842°C at 760 mmHg (Cal.) |
| Flash point | 211.947°C (Cal.) |
| Refractive index | 1.646 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Dimethylamino)Naphtho[2,3-b]Furan-4,9-Dione |