| Excenen Pharmatech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (20) 8565-3352 | |||
![]() |
contact@excenen.com | |||
| Chemical manufacturer | ||||
| Proactive Molecular Research | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (352) 505-2681 | |||
![]() |
tony@proactivemr.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1-[6-(Dimethylamino)-2-naphthyl]ethanone |
|---|---|
| Synonyms | 1-(6-(Dimethylamino)naphthalen-2-yl)ethanone |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.27 |
| CAS Registry Number | 68520-00-3 |
| SMILES | CC(=O)c1ccc2cc(ccc2c1)N(C)C |
| InChI | 1S/C14H15NO/c1-10(16)11-4-5-13-9-14(15(2)3)7-6-12(13)8-11/h4-9H,1-3H3 |
| InChIKey | FUVQYVZTQJOEQT-UHFFFAOYSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.832°C at 760 mmHg (Cal.) |
| Flash point | 147.919°C (Cal.) |
| (1) | Valentina Trapani, Giovanna Farruggia, Chiara Marraccini, Stefano Iotti, Achille Cittadini and Federica I. Wolf. Intracellular magnesium detection: imaging a brighter future, Analyst, 2010, 135, 1855. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[6-(Dimethylamino)-2-naphthyl]ethanone |