|
CAS#: 2114-29-6 Product: 1-Phenylpropyl Acetate No suppilers available for the product. |
| Name | 1-Phenylpropyl Acetate |
|---|---|
| Synonyms | Acetic Acid 1-Phenylpropyl Ester; 1-Phenylpropyl Ethanoate; Ai3-20523 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 2114-29-6 |
| EINECS | 218-312-2 |
| SMILES | C1=CC=C(C=C1)C(OC(=O)C)CC |
| InChI | 1S/C11H14O2/c1-3-11(13-9(2)12)10-7-5-4-6-8-10/h4-8,11H,3H2,1-2H3 |
| InChIKey | KPUCACGWLYWKKD-UHFFFAOYSA-N |
| Density | 1.013g/cm3 (Cal.) |
|---|---|
| Boiling point | 229.507°C at 760 mmHg (Cal.) |
| Flash point | 91.675°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylpropyl Acetate |