Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Phenyl-N-Propylacetamide |
|---|---|
| Synonyms | N-Phenyl-N-Propyl-Acetamide; N-Phenyl-N-Propyl-Ethanamide; Acetamide, N-Phenyl-N-Propyl- |
| Molecular Structure |  |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 2437-98-1 |
| SMILES | C1=C(N(CCC)C(C)=O)C=CC=C1 |
| InChI | 1S/C11H15NO/c1-3-9-12(10(2)13)11-7-5-4-6-8-11/h4-8H,3,9H2,1-2H3 |
| InChIKey | PREAZHGTUOIWRL-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.429°C at 760 mmHg (Cal.) |
| Flash point | 109.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-N-Propylacetamide |