Online Database of Chemicals from Around the World
|
CAS#: 21271-15-8 Product: 2,3,5,6,7,8-Hexafluoroquinoxaline No suppilers available for the product. |
| Name | 2,3,5,6,7,8-Hexafluoroquinoxaline |
|---|---|
| Synonyms | Quinoxaline, Hexafluoro-; Quinoxaline,Hexafluoro- |
| Molecular Structure |  |
| Molecular Formula | C8F6N2 |
| Molecular Weight | 238.09 |
| CAS Registry Number | 21271-15-8 |
| SMILES | C1(=C2C(=C(C(=C1F)F)F)N=C(F)C(=N2)F)F |
| InChI | 1S/C8F6N2/c9-1-2(10)4(12)6-5(3(1)11)15-7(13)8(14)16-6 |
| InChIKey | YCIAGHKSOFGGFT-UHFFFAOYSA-N |
| Density | 1.76g/cm3 (Cal.) |
|---|---|
| Boiling point | 261.398°C at 760 mmHg (Cal.) |
| Flash point | 111.89°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,6,7,8-Hexafluoroquinoxaline |