|
CAS#: 94412-88-1 Product: 2-(1,1,2,3,3,3-Hexafluoropropyl)-1,4-dioxane No suppilers available for the product. |
| Name | 2-(1,1,2,3,3,3-Hexafluoropropyl)-1,4-dioxane |
|---|---|
| Synonyms | 2-(1,1,2,3,3,3-Hexafluoro-propyl)-[1,4]dioxane |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8F6O2 |
| Molecular Weight | 238.13 |
| CAS Registry Number | 94412-88-1 |
| SMILES | C1COC(CO1)C(C(C(F)(F)F)F)(F)F |
| InChI | 1S/C7H8F6O2/c8-5(7(11,12)13)6(9,10)4-3-14-1-2-15-4/h4-5H,1-3H2 |
| InChIKey | NNTBXTUVWBLBKN-UHFFFAOYSA-N |
| Density | 1.389g/cm3 (Cal.) |
|---|---|
| Boiling point | 175.537°C at 760 mmHg (Cal.) |
| Flash point | 66.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,1,2,3,3,3-Hexafluoropropyl)-1,4-dioxane |