Online Database of Chemicals from Around the World
|
CAS#: 21273-08-5 Product: Trimethylsilyl Phenoxyacetate No suppilers available for the product. |
| Name | Trimethylsilyl Phenoxyacetate |
|---|---|
| Synonyms | ACETIC ACID,PHENOXY,TRIMETHYLSILYL ESTER; Trimethylsilyl phenoxyacetate # |
| Molecular Structure |  |
| Molecular Formula | C11H16O3Si |
| Molecular Weight | 224.33 |
| CAS Registry Number | 21273-08-5 |
| SMILES | O=C(O[Si](C)(C)C)COc1ccccc1 |
| InChI | 1S/C11H16O3Si/c1-15(2,3)14-11(12)9-13-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | DOSHUJGCYZNXCI-UHFFFAOYSA-N |
| Density | 1.026g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.271°C at 760 mmHg (Cal.) |
| Flash point | 90.985°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl Phenoxyacetate |