Online Database of Chemicals from Around the World
|
CAS#: 21273-14-3 Product: Trimethylsilyl 11-Phenoxyundecanoate No suppilers available for the product. |
| Name | Trimethylsilyl 11-Phenoxyundecanoate |
|---|---|
| Synonyms | Trimethylsilyl 11-phenoxyundecanoate # |
| Molecular Structure |  |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.57 |
| CAS Registry Number | 21273-14-3 |
| SMILES | O=C(O[Si](C)(C)C)CCCCCCCCCCOc1ccccc1 |
| InChI | 1S/C20H34O3Si/c1-24(2,3)23-20(21)17-13-8-6-4-5-7-9-14-18-22-19-15-11-10-12-16-19/h10-12,15-16H,4-9,13-14,17-18H2,1-3H3 |
| InChIKey | ROBPYOXGQOGYNO-UHFFFAOYSA-N |
| Density | 0.955g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.192°C at 760 mmHg (Cal.) |
| Flash point | 163.217°C (Cal.) |
| Refractive index | 1.476 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsilyl 11-Phenoxyundecanoate |