Online Database of Chemicals from Around the World
| Name | 1-[4-(3,4-Dimethylphenoxy)Phenyl]Ethanone |
|---|---|
| Molecular Structure | ![CAS#: 213014-13-2， 1-[4-(3,4-Dimethylphenoxy)Phenyl]Ethanone](/moreStructures/213014-13-2.gif) |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 213014-13-2 |
| SMILES | O=C(c2ccc(Oc1cc(c(cc1)C)C)cc2)C |
| InChI | 1S/C16H16O2/c1-11-4-7-16(10-12(11)2)18-15-8-5-14(6-9-15)13(3)17/h4-10H,1-3H3 |
| InChIKey | ABRMUKBXEGDKFN-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.27°C at 760 mmHg (Cal.) |
| Flash point | 158.042°C (Cal.) |
| Refractive index | 1.559 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-[4-(3,4-Dimethylphenoxy)Phenyl]Ethanone |
