|
CAS#: 2142-35-0 Product: 1,2,4,5-Tetrachloro-3,6-Bis(Trichloromethyl)Benzene No suppilers available for the product. |
| Name | 1,2,4,5-Tetrachloro-3,6-Bis(Trichloromethyl)Benzene |
|---|---|
| Synonyms | 1,2,4,5-Tetrachloro-3,6-bis(trichloromethyl)benzene #; Decachloro-p-xylene; Perchloro-p-xylene |
| Molecular Structure | ![]() |
| Molecular Formula | C8Cl10 |
| Molecular Weight | 450.62 |
| CAS Registry Number | 2142-35-0 |
| SMILES | Clc1c(c(Cl)c(Cl)c(c1Cl)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | 1S/C8Cl10/c9-3-1(7(13,14)15)4(10)6(12)2(5(3)11)8(16,17)18 |
| InChIKey | DTOMKKRROVKOGE-UHFFFAOYSA-N |
| Density | 1.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.884°C at 760 mmHg (Cal.) |
| Flash point | 206.522°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrachloro-3,6-Bis(Trichloromethyl)Benzene |