Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(1R,2R)-2-Ethoxycyclopropyl]Naphthalene |
|---|---|
| Synonyms | 2-((1R,2R)-2-ethoxycyclopropyl)naphthalene |
| Molecular Structure | ![CAS#: 215882-24-9， 2-[(1R,2R)-2-Ethoxycyclopropyl]Naphthalene](/moreStructures/215882-24-9.gif) |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 |
| CAS Registry Number | 215882-24-9 |
| SMILES | CCO[C@@H]1C[C@@H]1C2=CC3=CC=CC=C3C=C2 |
| InChI | 1S/C15H16O/c1-2-16-15-10-14(15)13-8-7-11-5-3-4-6-12(11)9-13/h3-9,14-15H,2,10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ZXBWZRGGAMJRFP-HUUCEWRRSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.4±31.0°C at 760 mmHg (Cal.) |
| Flash point | 154.3±20.5°C (Cal.) |
| Refractive index | 1.605 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(1R,2R)-2-Ethoxycyclopropyl]Naphthalene |