Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Ethoxy-1H-1,3-diazepin-1-yl)ethanone |
|---|---|
| Synonyms | 1-(2-ethoxy-1H-1,3-diazepin-1-yl)ethanone |
| Molecular Structure |  |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 713116-66-6 |
| SMILES | CC(=O)N1/C=C\C=C/N=C1/OCC |
| InChI | 1S/C9H12N2O2/c1-3-13-9-10-6-4-5-7-11(9)8(2)12/h4-7H,3H2,1-2H3 |
| InChIKey | NICQMYUALXSBHG-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.701°C at 760 mmHg (Cal.) |
| Flash point | 113.283°C (Cal.) |
| Refractive index | 1.517 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Ethoxy-1H-1,3-diazepin-1-yl)ethanone |