Online Database of Chemicals from Around the World
|
CAS#: 21641-70-3 Product: 1,2,3,4,5,6,7,8,8-Nonachloro-3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indene No suppilers available for the product. |
| Name | 1,2,3,4,5,6,7,8,8-Nonachloro-3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indene |
|---|---|
| Synonyms | 1,2,3,4,5,6,7,8,8-Nonachloro-3A,4,7,7A-Tetrahyd*; 1,2,3,4,5,6,7,8,8-Nonachloro-3A,4,7,7A-Tetrachloro-4,7-Methano-1H-Indene; 4,7-Methano-1H-Indene, 1,2,3,4,5,6,7,8,8-Nonachloro-3A,4,7,7A-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C10H3Cl9 |
| Molecular Weight | 442.21 |
| CAS Registry Number | 21641-70-3 |
| SMILES | C2(C1C3(C(C(C1C(=C2Cl)Cl)(C(=C3Cl)Cl)Cl)(Cl)Cl)Cl)Cl |
| InChI | 1S/C10H3Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-3H |
| InChIKey | RGZSEYASMOOVQZ-UHFFFAOYSA-N |
| Density | 1.92g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.14°C at 760 mmHg (Cal.) |
| Flash point | 231.51°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6,7,8,8-Nonachloro-3a,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indene |