Online Database of Chemicals from Around the World
|
CAS#: 3734-49-4 Product: (1alpha,2beta,3alpha,3aalpha,4beta,7beta,7aalpha)-1,2,3,4,5,6,7,8,8-Nonachlor-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene No suppilers available for the product. |
| Name | (1alpha,2beta,3alpha,3aalpha,4beta,7beta,7aalpha)-1,2,3,4,5,6,7,8,8-Nonachlor-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene |
|---|---|
| Synonyms | Trans-Nonachlor; T-Nonachlor; 4,7-Methanoindan, 1,2,3,4,5,6,7,8,8-Nonachloro-3A,4,7,7A-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C10H5Cl9 |
| Molecular Weight | 444.23 |
| CAS Registry Number | 3734-49-4 |
| SMILES | C2(C1C3(C(C(Cl)(C1C(Cl)C2Cl)C(=C3Cl)Cl)(Cl)Cl)Cl)Cl |
| InChI | 1S/C10H5Cl9/c11-3-1-2(4(12)5(3)13)9(17)7(15)6(14)8(1,16)10(9,18)19/h1-5H |
| InChIKey | OCHOKXCPKDPNQU-UHFFFAOYSA-N |
| Density | 1.863g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.383°C at 760 mmHg (Cal.) |
| Flash point | 229.121°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1alpha,2beta,3alpha,3aalpha,4beta,7beta,7aalpha)-1,2,3,4,5,6,7,8,8-Nonachlor-2,3,3a,4,7,7a-Hexahydro-4,7-Methano-1H-Indene |