Online Database of Chemicals from Around the World
|
CAS#: 2172-49-8 Product: 3,3,3-Tris(4-Chlorophenyl)Propanoyl Chloride No suppilers available for the product. |
| Name | 3,3,3-Tris(4-Chlorophenyl)Propanoyl Chloride |
|---|---|
| Synonyms | 3,3,3-Tris(4-Chlorophenyl)Propionyl Chloride; 3,3,3-Tris(P-Chlorophenyl)Propionyl Chloride |
| Molecular Structure |  |
| Molecular Formula | C21H14Cl4O |
| Molecular Weight | 424.15 |
| CAS Registry Number | 2172-49-8 |
| EINECS | 218-525-0 |
| SMILES | C3=C(C(CC(=O)Cl)(C1=CC=C(C=C1)Cl)C2=CC=C(C=C2)Cl)C=CC(=C3)Cl |
| InChI | 1S/C21H14Cl4O/c22-17-7-1-14(2-8-17)21(13-20(25)26,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-12H,13H2 |
| InChIKey | FPBMIAQHNZESKZ-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.144°C at 760 mmHg (Cal.) |
| Flash point | 217.931°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,3-Tris(4-Chlorophenyl)Propanoyl Chloride |