Online Database of Chemicals from Around the World
|
CAS#: 217311-57-4 Product: (1R,2S)-2-Hydroxycyclohexanecarbohydrazide No suppilers available for the product. |
| Name | (1R,2S)-2-Hydroxycyclohexanecarbohydrazide |
|---|---|
| Synonyms | (1R,2S)-2-hydroxycyclohexanecarbohydrazide |
| Molecular Structure |  |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 |
| CAS Registry Number | 217311-57-4 |
| SMILES | O=C(NN)[C@@H]1CCCC[C@@H]1O |
| InChI | 1S/C7H14N2O2/c8-9-7(11)5-3-1-2-4-6(5)10/h5-6,10H,1-4,8H2,(H,9,11)/t5-,6+/m1/s1 |
| InChIKey | JEQMQBRLQLBAEY-RITPCOANSA-N |
| Density | 1.211g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.054°C at 760 mmHg (Cal.) |
| Flash point | 184.255°C (Cal.) |
| Refractive index | 1.539 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-Hydroxycyclohexanecarbohydrazide |