Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Chemical reagent >> Organic reagent >> Amide |
|---|---|
| Name | cis-2-Hydroxy-1-Cyclohexanecarboxamide |
| Synonyms | (1R,2S)-2-Hydroxy-1-Cyclohexanecarboxamide; Zinc01081409 |
| Molecular Structure |  |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 |
| CAS Registry Number | 73045-98-4 |
| SMILES | [C@H]1(C(=O)N)[C@@H](O)CCCC1 |
| InChI | 1S/C7H13NO2/c8-7(10)5-3-1-2-4-6(5)9/h5-6,9H,1-4H2,(H2,8,10)/t5-,6+/m1/s1 |
| InChIKey | ZYAHCVLOLCHGMC-RITPCOANSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.595°C at 760 mmHg (Cal.) |
| Flash point | 167.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-2-Hydroxy-1-Cyclohexanecarboxamide |