Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | 2-Methyl-2-Nitropropyl Methacrylate |
|---|---|
| Synonyms | 2-Methyl-2-nitropropyl methacrylate; 411809_ALDRICH |
| Molecular Structure |  |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 |
| CAS Registry Number | 2177-42-6 |
| SMILES | [O-][N+](=O)C(C)(COC(=O)\C(=C)C)C |
| InChI | 1S/C8H13NO4/c1-6(2)7(10)13-5-8(3,4)9(11)12/h1,5H2,2-4H3 |
| InChIKey | CXOOGGOQFGCERQ-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 268.018°C at 760 mmHg (Cal.) |
| Flash point | 112.137°C (Cal.) |
| Refractive index | 1.453 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Nitropropyl Methacrylate |