Online Database of Chemicals from Around the World
| Florida Center for Heterocyclic Compounds | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (352) 392-0554 | |||
 |
katritzky@chem.ufl.edu | |||
| Chemical manufacturer | ||||
| Name | N-(2-Methyl-2-Nitropropyl)Benzenamine |
|---|---|
| Synonyms | N-(2-Methyl-2-Nitro-Propyl)Aniline; (2-Methyl-2-Nitro-Propyl)-Phenyl-Amine; Ai3-28063 |
| Molecular Structure |  |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 5448-31-7 |
| SMILES | C1=C(NCC([N+]([O-])=O)(C)C)C=CC=C1 |
| InChI | 1S/C10H14N2O2/c1-10(2,12(13)14)8-11-9-6-4-3-5-7-9/h3-7,11H,8H2,1-2H3 |
| InChIKey | VXMCOYAYZHUGIT-UHFFFAOYSA-N |
| Density | 1.134g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.672°C at 760 mmHg (Cal.) |
| Flash point | 158.019°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Methyl-2-Nitropropyl)Benzenamine |