| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Carfilzomib Impurity 40 |
|---|---|
| Synonyms | 2'-Deoxy-5-(2-hydroxyethyl)-3',5'-bis-O-(4-methylbenzoyl)uridine |
| Molecular Structure | ![]() |
| Molecular Formula | C27H28N2O8 |
| Molecular Weight | 508.52 |
| CAS Registry Number | 2177287-70-4 |
| SMILES | O=C(C(C)=C)[C@@H](CC(C)C)NC(OC(C)(C)C)=O |
| Density | 1.4±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.633, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Carfilzomib Impurity 40 |