Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Phenyl-2,3-Naphthalimide |
|---|---|
| Synonyms | 2-Phenylbenzo[F]Isoindole-1,3-Quinone; Zinc02526449 |
| Molecular Structure |  |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 |
| CAS Registry Number | 21815-18-9 |
| SMILES | C1=CC=C2C(=C1)C=C3C(=C2)C(N(C3=O)C4=CC=CC=C4)=O |
| InChI | 1S/C18H11NO2/c20-17-15-10-12-6-4-5-7-13(12)11-16(15)18(21)19(17)14-8-2-1-3-9-14/h1-11H |
| InChIKey | SAJVJIKFDFLINJ-UHFFFAOYSA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.751°C at 760 mmHg (Cal.) |
| Flash point | 231.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-2,3-Naphthalimide |