Online Database of Chemicals from Around the World
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 451-7400 | |||
 |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 2-Phenylnaphthalene-1,4-Dione |
|---|---|
| Synonyms | 2-Phenyl-1,4-Naphthoquinone; Nsc167124; Zinc00290868 |
| Molecular Structure |  |
| Molecular Formula | C16H10O2 |
| Molecular Weight | 234.25 |
| CAS Registry Number | 2348-77-8 |
| SMILES | C1=C(C=CC=C1)C3=CC(=O)C2=C(C=CC=C2)C3=O |
| InChI | 1S/C16H10O2/c17-15-10-14(11-6-2-1-3-7-11)16(18)13-9-5-4-8-12(13)15/h1-10H |
| InChIKey | CIDYIYSNDAJNGX-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.267°C at 760 mmHg (Cal.) |
| Flash point | 154.995°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenylnaphthalene-1,4-Dione |