Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (386) 462-0788 | |||
|
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Name | 4-Fluorophenyl 3-(Trifluoromethyl)Benzoate |
|---|---|
| Synonyms | 4-Fluorophenyl3-(trifluoromethyl)benzoate; BENZOIC ACID,3-(TRIFLUOROMETHYL)-, 4-FLUOROPHENYL ESTER; ZINC00152764 |
| Molecular Structure |  |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 |
| CAS Registry Number | 218929-27-2 |
| SMILES | O=C(Oc1ccc(F)cc1)c2cccc(c2)C(F)(F)F |
| InChI | 1S/C14H8F4O2/c15-11-4-6-12(7-5-11)20-13(19)9-2-1-3-10(8-9)14(16,17)18/h1-8H |
| InChIKey | FDOAXLUDEAKGGJ-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.476°C at 760 mmHg (Cal.) |
| Flash point | 147.463°C (Cal.) |
| Refractive index | 1.509 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Fluorophenyl 3-(Trifluoromethyl)Benzoate |