Online Database of Chemicals from Around the World
|
CAS#: 87996-56-3 Product: (4-Fluorophenyl)[4-(trifluoromethoxy)phenyl]methanone No suppilers available for the product. |
| Name | (4-Fluorophenyl)[4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| Synonyms | 4'-fluoro-4-trifluoromethoxybenzophenone |
| Molecular Structure | ![CAS#: 87996-56-3， (4-Fluorophenyl)[4-(trifluoromethoxy)phenyl]methanone](/moreStructures/87996-56-3.gif) |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 |
| CAS Registry Number | 87996-56-3 |
| EINECS | 289-368-3 |
| SMILES | FC(F)(F)Oc1ccc(cc1)C(=O)c2ccc(F)cc2 |
| InChI | 1S/C14H8F4O2/c15-11-5-1-9(2-6-11)13(19)10-3-7-12(8-4-10)20-14(16,17)18/h1-8H |
| InChIKey | IIOBPWBQFJNASE-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.734°C at 760 mmHg (Cal.) |
| Flash point | 140.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Fluorophenyl)[4-(trifluoromethoxy)phenyl]methanone |