Online Database of Chemicals from Around the World
| Name | 1-Methoxytricyclo[4.3.1.13,8]Undecane |
|---|---|
| Molecular Structure | ![CAS#: 21898-95-3， 1-Methoxytricyclo[4.3.1.1<Sup>3,8</Sup>]Undecane](/moreStructures/21898-95-3.gif) |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 21898-95-3 |
| SMILES | O(C)C12CC3CC(C1)CC(C2)CC3 |
| InChI | 1S/C12H20O/c1-13-12-6-9-2-3-10(7-12)5-11(4-9)8-12/h9-11H,2-8H2,1H3 |
| InChIKey | PYIFYZYKFJFRER-UHFFFAOYSA-N |
| Density | 1.007g/cm3 (Cal.) |
|---|---|
| Boiling point | 233.456°C at 760 mmHg (Cal.) |
| Flash point | 88.137°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxytricyclo[4.3.1.13,8]Undecane |
