Online Database of Chemicals from Around the World
|
CAS#: 313-96-2 Product: 2-Methoxytricycloquinazoline No suppilers available for the product. |
| Name | 2-Methoxytricycloquinazoline |
|---|---|
| Synonyms | Tricycloquinazoline, 2-Methoxy-; 2-Methoxytricycloquinazoline |
| Molecular Structure |  |
| Molecular Formula | C22H14N4O |
| Molecular Weight | 350.38 |
| CAS Registry Number | 313-96-2 |
| SMILES | C1=CC=C2C(=C1)C3=NC6=C(C4=NC5=C(C(=N2)N34)C=CC(=C5)OC)C=CC=C6 |
| InChI | 1S/C22H14N4O/c1-27-13-10-11-16-19(12-13)25-21-15-7-3-5-9-18(15)23-20-14-6-2-4-8-17(14)24-22(16)26(20)21/h2-12H,1H3 |
| InChIKey | FVXWHWHDOBBMOQ-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.419°C at 760 mmHg (Cal.) |
| Flash point | 325.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxytricycloquinazoline |