Online Database of Chemicals from Around the World

1,1'-Sulfinylbis[3-fluorobenzene]
[CAS 2216787-21-0]

List of Suppliers
Shanghai Worldyang Chemical Co., Ltd. China
www.worldyachem.com
+86 13651600618
+86 (21) 5679-5779
+86 (21) 5679-5266
sales7777@worldyachem.com
QQ Chat
WeChat: 13651600618
WhatsApp:+86 13651600618
Chemical manufacturer since 2012

Identification
Name1,1'-Sulfinylbis[3-fluorobenzene]
Synonyms1-fluoro-3-(3-fluorophenyl)sulfinylbenzene
Molecular Structure1,1'-Sulfinylbis[3-fluorobenzene] molecular structure (CAS 2216787-21-0)
Molecular FormulaC12H8F2OS
Molecular Weight238.25
CAS Registry Number2216787-21-0
SMILESC1=CC(=CC(=C1)S(=O)C2=CC=CC(=C2)F)F
up Discovery and Applications
1,1'-Sulfinylbis[3-fluorobenzene], commonly abbreviated as SFB, is a unique organosulfur compound characterized by two 3-fluorophenyl groups connected by a sulfinyl (SO) bridge. The discovery of 1,1'-sulfinylbis[3-fluorobenzene] is part of the ongoing research into sulfinyl compounds, which are known for their stability and potential applications in different fields. The structural feature of SFB is that the sulfur atom is double-bonded to oxygen and single-bonded to two 3-fluorophenyl groups. This sulfinyl bond is influenced by the electron-withdrawing fluorine atom at the 3-position of the benzene ring, which has unique electronic properties.

SFB is synthesized by oxidation of bis(3-fluorophenyl) sulfide using oxidants such as hydrogen peroxide or m-chloroperbenzoic acid (m-CPBA). The process highlights the transformation of the sulfur bridge from sulfide to sulfinyl, which enhances the chemical reactivity of the compound. SFB is in the form of a crystalline solid with stability and unique electronic properties. The fluorine atom has an electron-withdrawing effect that affects the reactivity and interaction of the compound in various chemical environments.

SFB is a valuable intermediate in organic synthesis. Its sulfenyl bridge provides a point for chemical modification, enabling the construction of complex molecules. This utility is critical for the synthesis of pharmaceuticals and advanced materials that require precise structural features.

In cross-coupling reactions such as the Suzuki-Miyaura coupling reaction, SFB serves as an effective building block. The fluorine atom enhances the reactivity of the aromatic ring and promotes the formation of carbon-carbon bonds. This property is critical for creating diverse molecular structures for drug discovery and materials science.

The sulfenyl group of SFB allows for further functionalization, enabling the introduction of additional substituents. This flexibility is valuable for developing molecules with customized properties.

SFB is used to develop organic electronic materials. Its unique electronic properties, influenced by the fluorine atom and the sulfenyl bridge, make it suitable for the manufacture of semiconductors and light-emitting materials. These materials are critical for the development of organic light-emitting diodes (OLEDs) and other flexible electronic devices.

The compound is used in the synthesis of fluorinated polymers, which have excellent thermal stability and chemical resistance. These polymers can be used in materials that require high performance, such as coatings, membranes, and electronic components. Fluorine atoms enhance the durability and performance of polymers in harsh environments.

SFB can be used as a scaffold for drug discovery, providing multiple points for chemical modification. Researchers use it to design derivatives with potential therapeutic properties, targeting various biological pathways. This application is critical for developing new drugs with higher efficacy and fewer side effects.

SFB derivatives are explored as anticancer agents. The structure of the compound allows for interaction with cancer-related proteins, making it a candidate for developing drugs that inhibit cancer cell growth. Research aims to optimize these derivatives to enhance activity and reduce toxicity.

The compound is studied for the development of enzyme inhibitors. The sulfenyl and fluorine atoms of SFB contribute to the binding affinity of the compound to the active site of the enzyme, providing a potential treatment for diseases related to enzyme regulation, such as cancer and metabolic disorders.
Market Analysis Reports
Related Products
3-Sulfinobenzoi...  N-(Sulfinocarbo...  4-Sulfino-1H-Im...  [[4-[4-(Sulfino...  3-Sulfinopropan...  3-Sulfino-DL-va...  (+/-)-Sulfinpyr...  N-Sulfinylaceta...  4-(Sulfinylamin...  2,2'-Sulfinylbi...  2,2'-Sulfinylbi...  1,1'-[Sulfinylb...  3,3'-Sulfinylbi...  N-Sulfinyl-2-Ch...  N-Sulfinyl-4-Ch...  1,1'-[Sulfinyld...  1-Sulfinylethan...  N-Sulfinyl-p-to...  N-Sulfinyl-O-To...  N-Sulfinyl-p-To...