|
CAS#: 22180-01-4 Product: 4-m-Tolyloxy-Butyric Acid No suppilers available for the product. |
| Name | 4-m-Tolyloxy-Butyric Acid |
|---|---|
| Synonyms | 4-(3-Methylphenoxy)Butyrate; Zinc01871364 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13O3 |
| Molecular Weight | 193.22 |
| CAS Registry Number | 22180-01-4 |
| SMILES | C1=C(C=CC=C1OCCCC([O-])=O)C |
| InChI | 1S/C11H14O3/c1-9-4-2-5-10(8-9)14-7-3-6-11(12)13/h2,4-5,8H,3,6-7H2,1H3,(H,12,13)/p-1 |
| InChIKey | DAEUMJMOLYOQFB-UHFFFAOYSA-M |
| Boiling point | 369.069°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-m-Tolyloxy-Butyric Acid |