|
CAS#: 22180-02-5 Product: 4-p-Tolyloxy-Butyric Acid No suppilers available for the product. |
| Name | 4-p-Tolyloxy-Butyric Acid |
|---|---|
| Synonyms | 4-(4-Methylphenoxy)Butyrate; Zinc01694009 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13O3 |
| Molecular Weight | 193.22 |
| CAS Registry Number | 22180-02-5 |
| SMILES | C1=C(OCCCC([O-])=O)C=CC(=C1)C |
| InChI | 1S/C11H14O3/c1-9-4-6-10(7-5-9)14-8-2-3-11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13)/p-1 |
| InChIKey | UQLYOAIYJDZSQG-UHFFFAOYSA-M |
| Boiling point | 366.415°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.032°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-p-Tolyloxy-Butyric Acid |