Online Database of Chemicals from Around the World
|
CAS#: 2221-81-0 Product: (-)-alpha-Cyclocostunolide No suppilers available for the product. |
| Name | (-)-alpha-Cyclocostunolide |
|---|---|
| Synonyms | (3As,5Ar,9Ar,9Bs)-5A,9-Dimethyl-3-Methylene-4,5,6,7,9A,9B-Hexahydro-3Ah-Benzo[G]Benzofuran-2-One; Cyclocostunolide; Naphtho(1,2-B)Furan-2(3H)-One, 3A,4,5,5A,6,7,9A,9B-Octahydro-5A,9-Dimethyl-3-Methylene-, (3As-(3Aalpha,5Abeta,9Aalpha,9Bbeta))- |
| Molecular Structure |  |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 2221-81-0 |
| SMILES | [C@H]12OC(=O)C([C@@H]1CC[C@@]3([C@@H]2C(=CCC3)C)C)=C |
| InChI | 1S/C15H20O2/c1-9-5-4-7-15(3)8-6-11-10(2)14(16)17-13(11)12(9)15/h5,11-13H,2,4,6-8H2,1,3H3/t11-,12+,13-,15+/m0/s1 |
| InChIKey | UHODXTMZSDNATP-SFDCQRBFSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.159°C at 760 mmHg (Cal.) |
| Flash point | 152.339°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-alpha-Cyclocostunolide |