Online Database of Chemicals from Around the World
|
CAS#: 2221-82-1 Product: (+)-beta-Cyclocostunolide No suppilers available for the product. |
| Name | (+)-beta-Cyclocostunolide |
|---|---|
| Synonyms | (3As,5Ar,9As,9Bs)-5A-Methyl-3,9-Dimethylene-3A,4,5,6,7,8,9A,9B-Octahydrobenzo[G]Benzofuran-2-One; Naphtho[1,2-B]Furan-2(3H)-One, Decahydro-5A-Methyl-3,9-Dimethylene-, (3As,5Ar,9As,9Bs)-; Aids-114261 |
| Molecular Structure |  |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 |
| CAS Registry Number | 2221-82-1 |
| SMILES | [C@H]12OC(=O)C([C@@H]1CC[C@@]3([C@@H]2C(=C)CCC3)C)=C |
| InChI | 1S/C15H20O2/c1-9-5-4-7-15(3)8-6-11-10(2)14(16)17-13(11)12(9)15/h11-13H,1-2,4-8H2,3H3/t11-,12+,13-,15+/m0/s1 |
| InChIKey | XUYAKPXYKQEFPD-SFDCQRBFSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.88°C at 760 mmHg (Cal.) |
| Flash point | 152.67°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-beta-Cyclocostunolide |