Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 1-Pyren-4-Yl-Ethanone |
|---|---|
| Synonyms | 1-(4-Pyrenyl)Ethanone; 4-Acetylpyrene; Ethanone, 1-(4-Pyrenyl)- |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 22245-47-2 |
| SMILES | C1=C3C=CC=C4C=CC2=CC=CC(=C1C(C)=O)C2=C34 |
| InChI | 1S/C18H12O/c1-11(19)16-10-14-6-2-4-12-8-9-13-5-3-7-15(16)18(13)17(12)14/h2-10H,1H3 |
| InChIKey | LJJNTECEYWTOJN-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.707°C at 760 mmHg (Cal.) |
| Flash point | 195.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Pyren-4-Yl-Ethanone |