Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-[4-(1-Pyrenyl)Butanoyl]Glycylglycylphenylalanine |
|---|---|
| Synonyms | N-4-(1-Pyrene)butyroylglycylglycyl-L-phenylalanine |
| Molecular Structure | ![CAS#: 228414-53-7， N-[4-(1-Pyrenyl)Butanoyl]Glycylglycylphenylalanine](/moreStructures/228414-53-7.gif) |
| Molecular Formula | C33H31N3O5 |
| Molecular Weight | 549.62 |
| CAS Registry Number | 228414-53-7 |
| SMILES | O=C(NCC(=O)NCC(=O)NC(C(=O)O)Cc1ccccc1)CCCc5c2c4c3c(cc2)cccc3ccc4cc5 |
| InChI | 1S/C33H31N3O5/c37-28(34-19-29(38)35-20-30(39)36-27(33(40)41)18-21-6-2-1-3-7-21)11-5-8-22-12-13-25-15-14-23-9-4-10-24-16-17-26(22)32(25)31(23)24/h1-4,6-7,9-10,12-17,27H,5,8,11,18-20H2,(H,34,37)(H,35,38)(H,36,39)(H,40,41) |
| InChIKey | HTURFCDSXIXFGP-UHFFFAOYSA-N |
| Density | 1.318g/cm3 (Cal.) |
|---|---|
| Boiling point | 946.618°C at 760 mmHg (Cal.) |
| Flash point | 526.296°C (Cal.) |
| Refractive index | 1.697 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(1-Pyrenyl)Butanoyl]Glycylglycylphenylalanine |