Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Bornelone |
|---|---|
| Synonyms | (E,5Z)-5-(3,3-Dimethylnorbornan-2-Ylidene)Pent-3-En-2-One; (E,5Z)-5-(3,3-Dimethyl-2-Norbornanylidene)Pent-3-En-2-One; (3E,5Z)-5-(3,3-Dimethyl-8,9,10-Trinorborn-2-Yliden)-3-Penten-2-On |
| Molecular Structure |  |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 |
| CAS Registry Number | 2226-11-1 |
| EINECS | 218-757-2 |
| SMILES | CC1(C(/C2CC1CC2)=C\C=C\C(C)=O)C |
| InChI | 1S/C14H20O/c1-10(15)5-4-6-13-11-7-8-12(9-11)14(13,2)3/h4-6,11-12H,7-9H2,1-3H3/b5-4+,13-6- |
| InChIKey | WDMFHQNUSVLQMS-XFYQWYMDSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.75°C at 760 mmHg (Cal.) |
| Flash point | 135.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bornelone |