| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | Nonafluoropentanenitrile |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,5-nonafluoropentanenitrile; MFCD04039182; Nonafluoropentanenitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C5F9N |
| Molecular Weight | 245.05 |
| CAS Registry Number | 22325-71-9 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C#N |
| InChI | 1S/C5F9N/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14 |
| InChIKey | FVBKAFXHWXBINM-UHFFFAOYSA-N |
| Density | 1.595g/cm3 (Cal.) |
|---|---|
| Boiling point | -15°C (Expl.) |
| 48.077°C at 760 mmHg (Cal.) | |
| Flash point | -17.122°C (Cal.) |
| Refractive index | 1.274 (Cal.) |
| Safety Description | Irritant |
|---|---|
| R36/37/38 | |
| S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Nonafluoropentanenitrile |