| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 2,2,3,3,4,4,5,5,5-Nonafluoropentanal |
|---|---|
| Synonyms | 2,2,3,3,4,4,5,5,5-nonafluoropentane-1,1-diol; MFCD00447515; Nonafluoropentaldehyde hydrate |
| Molecular Structure | ![]() |
| Molecular Formula | C5HF9O |
| Molecular Weight | 248.05 |
| CAS Registry Number | 355-30-6 |
| SMILES | FC(F)(C(F)(F)C(F)(F)F)C(F)(F)C=O |
| InChI | 1S/C5HF9O/c6-2(7,1-15)3(8,9)4(10,11)5(12,13)14/h1H |
| InChIKey | ILSWGKFIWBVLDG-UHFFFAOYSA-N |
| Density | 1.574g/cm3 (Cal.) |
|---|---|
| Boiling point | 28.721°C at 760 mmHg (Cal.) |
| 45-52°C (Expl.) | |
| Flash point | -7.197°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,4,4,5,5,5-Nonafluoropentanal |