| NANJING DAOGE BIOPHARMA CO., LTD. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.daogepharm.com | |||
![]() | +86 18021503536 | |||
![]() | sale@daogepharm.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2021 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | 1-Chloro-4-hydroxyisoquinoline-3-carboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.61 |
| CAS Registry Number | 223388-21-4 |
| SMILES | C1=CC=C2C(=C1)C(=C(N=C2Cl)C(=O)O)O |
| Solubility | 83.64 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.732, Calc.* |
| Melting point | 165.33 °C |
| Boiling Point | 398.80 °C, 511.0±50.0 °C (760 mmHg), Calc.* |
| Flash Point | 262.8±30.1 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P330-P362-P403+P233-P501 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-hydroxyisoquinoline-3-carboxylic acid |