Online Database of Chemicals from Around the World
|
CAS#: 95094-67-0 Product: (Z)-1-Chloro-N-hydroxy-1-(3H-indol-3-ylidene)methanamine No suppilers available for the product. |
| Name | (Z)-1-Chloro-N-hydroxy-1-(3H-indol-3-ylidene)methanamine |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 |
| CAS Registry Number | 95094-67-0 |
| SMILES | Cl/C(=C1/c2ccccc2\N=C1)NO |
| InChI | 1S/C9H7ClN2O/c10-9(12-13)7-5-11-8-4-2-1-3-6(7)8/h1-5,12-13H/b9-7- |
| InChIKey | NDUNSCYMRSAIOO-CLFYSBASSA-N |
| Density | 1.427g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.404°C at 760 mmHg (Cal.) |
| Flash point | 163.299°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-1-Chloro-N-hydroxy-1-(3H-indol-3-ylidene)methanamine |