Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N-Acetyl-N-(Benzyloxy)-2-Phenylacetamide |
|---|---|
| Synonyms | Benzeneacetamide, N-acetyl-N-(phenylmethoxy)-; N-Acetyl-N-(benzyloxy)-2-phenylacetamid; N-Acetyl-N-(benzyloxy)-2-phenylacetamide |
| Molecular Structure |  |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.32 |
| CAS Registry Number | 22426-99-9 |
| SMILES | CC(=O)N(C(=O)Cc1ccccc1)OCc2ccccc2 |
| InChI | 1S/C17H17NO3/c1-14(19)18(21-13-16-10-6-3-7-11-16)17(20)12-15-8-4-2-5-9-15/h2-11H,12-13H2,1H3 |
| InChIKey | DXKWHGABTPAPQL-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.6±48.0°C at 760 mmHg (Cal.) |
| Flash point | 207.0±29.6°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-N-(Benzyloxy)-2-Phenylacetamide |