| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sequoia Research Products Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (7802) 291-086 | |||
![]() |
info@seqchem.com | |||
| Chemical distributor | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Cysteine derivative |
|---|---|
| Name | N-Acetyl-S-Benzyl-L-Cysteine Methyl Ester |
| Synonyms | (2R)-2-Acetamido-3-(Phenylmethylthio)Propanoic Acid Methyl Ester; (2R)-2-Acetamido-3-(Benzylthio)Propionic Acid Methyl Ester; St5406108 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.34 |
| CAS Registry Number | 77549-14-5 |
| SMILES | [C@H](C(=O)OC)(NC(=O)C)CSCC1=CC=CC=C1 |
| InChI | 1S/C13H17NO3S/c1-10(15)14-12(13(16)17-2)9-18-8-11-6-4-3-5-7-11/h3-7,12H,8-9H2,1-2H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | NELLUUAGFXJBKY-LBPRGKRZSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.447°C at 760 mmHg (Cal.) |
| Flash point | 226.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetyl-S-Benzyl-L-Cysteine Methyl Ester |