Online Database of Chemicals from Around the World
|
CAS#: 22427-95-8 Product: (3E,7E)-4,7-Dimethyl-3,7-Decadiene-5,6-Diol No suppilers available for the product. |
| Name | (3E,7E)-4,7-Dimethyl-3,7-Decadiene-5,6-Diol |
|---|---|
| Synonyms | (3E,7E)-4,7-Dimethyl-3,7-decadiene-5,6-diol # |
| Molecular Structure |  |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 22427-95-8 |
| SMILES | OC(/C(=C/CC)C)C(O)C(=C/CC)/C |
| InChI | 1S/C12H22O2/c1-5-7-9(3)11(13)12(14)10(4)8-6-2/h7-8,11-14H,5-6H2,1-4H3/b9-7+,10-8+ |
| InChIKey | QNCRNSNKSVAFLB-FIFLTTCUSA-N |
| Density | 0.948g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.804°C at 760 mmHg (Cal.) |
| Flash point | 143.96°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3E,7E)-4,7-Dimethyl-3,7-Decadiene-5,6-Diol |