Online Database of Chemicals from Around the World
|
CAS#: 40518-76-1 Product: 5,9-Dimethyl-4,8-Decadienoic Acid No suppilers available for the product. |
| Name | 5,9-Dimethyl-4,8-Decadienoic Acid |
|---|---|
| Synonyms | 5,9-Dimethyl-4,8-Decadienoic Acid |
| Molecular Structure |  |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 40518-76-1 |
| EINECS | 254-951-3 |
| SMILES | C(C(=O)O)C/C=C(/CCC=C(C)C)C |
| InChI | 1S/C12H20O2/c1-10(2)6-4-7-11(3)8-5-9-12(13)14/h6,8H,4-5,7,9H2,1-3H3,(H,13,14)/b11-8+ |
| InChIKey | HPOYZGTYWKRTPU-DHZHZOJOSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.925°C at 760 mmHg (Cal.) |
| Flash point | 212.997°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,9-Dimethyl-4,8-Decadienoic Acid |