Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Analytical chemistry >> Standard >> Volatile organic compounds (VOCs) |
|---|---|
| Name | Benz[a]Acridine |
| Synonyms | 1,2-Benzacridine; 5-20-08-00519 (Beilstein Handbook Reference); 7-Azabenz(A)Anthracene |
| Molecular Structure | ![CAS#: 225-11-6， Benz[a]Acridine](/moreStructures/225-11-6.gif) |
| Molecular Formula | C17H11N |
| Molecular Weight | 229.28 |
| CAS Registry Number | 225-11-6 |
| EINECS | 205-929-7 |
| SMILES | C2=CC1=CC3=C(N=C1C=C2)C=CC4=C3C=CC=C4 |
| InChI | 1S/C17H11N/c1-3-7-14-12(5-1)9-10-17-15(14)11-13-6-2-4-8-16(13)18-17/h1-11H |
| InChIKey | JEGZRTMZYUDVBF-UHFFFAOYSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.22°C at 760 mmHg (Cal.) |
| Flash point | 201.408°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Benz[a]Acridine |